C32H50O4 — CID 4105118
(9-formyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methyl formate (PubChem CID 4105118) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is (9-formyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methyl formate.
| Compound Name | (9-formyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methyl formate |
|---|---|
| PubChem CID | 4105118 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | (9-formyloxy-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-3a-yl)methyl formate |
| SMILES | C=C(C)C1CCC2(COC=O)CCC3(C)C(CCC4C5(C)CCC(OC=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C32H50O4/c1-21(2)22-10-15-32(18-35-19-33)17-16-30(6)23(27(22)32)8-9-25-29(5)13-12-26(36-20-34)28(3,4)24(29)11-14-31(25,30)7/h19-20,22-27H,1,8-18H2,2-7H3 |
| InChIKey | BCJRMIAGIXJFNK-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|