C33H50N2O3S — CID 4105120
methyl 10-[(carbamothioylamino)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate (PubChem CID 4105120) has the molecular formula C33H50N2O3S and a molecular weight of 554.84 g/mol. Its IUPAC name is methyl 10-[(carbamothioylamino)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate.
| Compound Name | methyl 10-[(carbamothioylamino)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate |
|---|---|
| PubChem CID | 4105120 |
| Molecular Formula | C33H50N2O3S |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | methyl 10-[(carbamothioylamino)methylidene]-5a,5b,8,8,11a-pentamethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carboxylate |
| SMILES | C=C(C)C1CCC2(C(=O)OC)CCC3(C)C(CCC4C5(C)CC(=CNC(N)=S)C(=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C33H50N2O3S/c1-19(2)21-11-14-33(27(37)38-8)16-15-31(6)22(25(21)33)9-10-24-30(5)17-20(18-35-28(34)39)26(36)29(3,4)23(30)12-13-32(24,31)7/h18,21-25H,1,9-17H2,2-8H3,(H3,34,35,39) |
| InChIKey | MOWARHWKOOUHNL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|