C22H17N5O6S — CID 41055475
N-(4-ethoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 41055475) has the molecular formula C22H17N5O6S and a molecular weight of 479.47 g/mol. Its IUPAC name is N-(4-ethoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 41055475 |
| Molecular Formula | C22H17N5O6S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | N-(4-ethoxy-1,3-benzothiazol-2-yl)-3,5-dinitro-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | CCOc1cccc2sc(N(Cc3ccccn3)C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C22H17N5O6S/c1-2-33-18-7-5-8-19-20(18)24-22(34-19)25(13-15-6-3-4-9-23-15)21(28)14-10-16(26(29)30)12-17(11-14)27(31)32/h3-12H,2,13H2,1H3 |
| InChIKey | HGKFMWDRQAXRRZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 141.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|