C22H26ClN4O4S- — CID 53351275
N-[2-(diethylamino)ethyl]-N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitrobenzamide chloride (PubChem CID 53351275) has the molecular formula C22H26ClN4O4S- and a molecular weight of 477.99 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitrobenzamide chloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitrobenzamide chloride |
|---|---|
| PubChem CID | 53351275 |
| Molecular Formula | C22H26ClN4O4S- |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4-ethoxy-1,3-benzothiazol-2-yl)-3-nitrobenzamide chloride |
| SMILES | CCOc1cccc2sc(N(CCN(CC)CC)C(=O)c3cccc([N+](=O)[O-])c3)nc12.[Cl-] |
| InChI | InChI=1S/C22H26N4O4S.ClH/c1-4-24(5-2)13-14-25(21(27)16-9-7-10-17(15-16)26(28)29)22-23-20-18(30-6-3)11-8-12-19(20)31-22;/h7-12,15H,4-6,13-14H2,1-3H3;1H/p-1 |
| InChIKey | VFHGPZRCCDMLEX-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|