C22H27ClN4O3S — CID 44926734
N-[2-(diethylamino)ethyl]-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride (PubChem CID 44926734) has the molecular formula C22H27ClN4O3S and a molecular weight of 463.00 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[2-(diethylamino)ethyl]-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 44926734 |
| Molecular Formula | C22H27ClN4O3S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N-(4,5-dimethyl-1,3-benzothiazol-2-yl)-3-nitrobenzamide;hydrochloride |
| SMILES | CCN(CC)CCN(C(=O)c1cccc([N+](=O)[O-])c1)c1nc2c(C)c(C)ccc2s1.Cl |
| InChI | InChI=1S/C22H26N4O3S.ClH/c1-5-24(6-2)12-13-25(21(27)17-8-7-9-18(14-17)26(28)29)22-23-20-16(4)15(3)10-11-19(20)30-22;/h7-11,14H,5-6,12-13H2,1-4H3;1H |
| InChIKey | UEORQAVCCMBPIU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|