C22H24N2O5S2 — CID 41057641
N-[(3aS,6aR)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,5-dimethoxybenzamide (PubChem CID 41057641) has the molecular formula C22H24N2O5S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[(3aS,6aR)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,5-dimethoxybenzamide.
| Compound Name | N-[(3aS,6aR)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 41057641 |
| Molecular Formula | C22H24N2O5S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-[(3aS,6aR)-5,5-dioxo-3-(2-phenylethyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)/N=C2\S[C@H]3CS(=O)(=O)C[C@@H]3N2CCc2ccccc2)c1 |
| InChI | InChI=1S/C22H24N2O5S2/c1-28-17-10-16(11-18(12-17)29-2)21(25)23-22-24(9-8-15-6-4-3-5-7-15)19-13-31(26,27)14-20(19)30-22/h3-7,10-12,19-20H,8-9,13-14H2,1-2H3/b23-22-/t19-,20-/m0/s1 |
| InChIKey | LSUAWZZJGAILAM-VMDIXPSDSA-N |
| XLogP | 2.66 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|