About 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol
2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol (PubChem CID 4105941) has the molecular formula C17H15Br2N3O
and a molecular weight of 437.14 g/mol. Its IUPAC name is 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol.
Molecular Properties
| Compound Name | 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol |
| PubChem CID | 4105941 |
| Molecular Formula | C17H15Br2N3O |
| Molecular Weight | 437.14 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol |
| SMILES | CCn1c(N=Cc2ccc(C)cc2O)nc2cc(Br)c(Br)cc21 |
| InChI | InChI=1S/C17H15Br2N3O/c1-3-22-15-8-13(19)12(18)7-14(15)21-17(22)20-9-11-5-4-10(2)6-16(11)23/h4-9,23H,3H2,1-2H3 |
| InChIKey | POLIJOPXLYOJFM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.14 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol?
The IUPAC name of 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol (CID 4105941) is 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol.
What is the SMILES notation for 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol?
The canonical SMILES for 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol is CCn1c(N=Cc2ccc(C)cc2O)nc2cc(Br)c(Br)cc21.
What is the InChIKey of 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol?
The InChIKey is POLIJOPXLYOJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Br2N3O/c1-3-22-15-8-13(19)12(18)7-14(15)21-17(22)20-9-11-5-4-10(2)6-16(11)23/h4-9,23H,3H2,1-2H3.
What are the key properties of 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol?
2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol has a molecular weight of 437.14 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,6-dibromo-1-ethylbenzimidazol-2-yl)iminomethyl]-5-methylphenol is sourced from PubChem (CID 4105941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).