C15H18ClN3O3S2 — CID 41064476
2-[(3aS,6aS)-3-(3-chlorophenyl)-5,5-dioxo-2-sulfanylidene-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N,N-dimethylacetamide (PubChem CID 41064476) has the molecular formula C15H18ClN3O3S2 and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-[(3aS,6aS)-3-(3-chlorophenyl)-5,5-dioxo-2-sulfanylidene-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(3aS,6aS)-3-(3-chlorophenyl)-5,5-dioxo-2-sulfanylidene-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 41064476 |
| Molecular Formula | C15H18ClN3O3S2 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-[(3aS,6aS)-3-(3-chlorophenyl)-5,5-dioxo-2-sulfanylidene-3a,4,6,6a-tetrahydrothieno[3,4-d]imidazol-1-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1C(=S)N(c2cccc(Cl)c2)[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H18ClN3O3S2/c1-17(2)14(20)7-18-12-8-24(21,22)9-13(12)19(15(18)23)11-5-3-4-10(16)6-11/h3-6,12-13H,7-9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | QUWGIZZEZFXVRA-CHWSQXEVSA-N |
| XLogP | 1.00 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|