C8H6BrClO2 — CID 4106642
2-bromo-5-chloro-3,6-dimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 4106642) has the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. Its IUPAC name is 2-bromo-5-chloro-3,6-dimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-5-chloro-3,6-dimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 4106642 |
| Molecular Formula | C8H6BrClO2 |
| Molecular Weight | 249.49 g/mol |
| Exact Mass | 247.92 |
| IUPAC Name | 2-bromo-5-chloro-3,6-dimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(Cl)C(=O)C(C)=C(Br)C1=O |
| InChI | InChI=1S/C8H6BrClO2/c1-3-5(9)7(11)4(2)6(10)8(3)12/h1-2H3 |
| InChIKey | BZNXZBDGMMFYMR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|