C26H27N3O5 — CID 41067376
(13R)-13-(2-hydroxyphenyl)-8-(4-methoxyphenyl)-3,5,10,10-tetramethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 41067376) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is (13R)-13-(2-hydroxyphenyl)-8-(4-methoxyphenyl)-3,5,10,10-tetramethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13R)-13-(2-hydroxyphenyl)-8-(4-methoxyphenyl)-3,5,10,10-tetramethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 41067376 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (13R)-13-(2-hydroxyphenyl)-8-(4-methoxyphenyl)-3,5,10,10-tetramethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | COc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3n2C(C)(C)CO[C@@H]3c2ccccc2O)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-26(2)14-34-23(17-8-6-7-9-18(17)30)22-21-19(24(31)28(4)25(32)27(21)3)20(29(22)26)15-10-12-16(33-5)13-11-15/h6-13,23,30H,14H2,1-5H3/t23-/m1/s1 |
| InChIKey | UCEMWPGHEXCWIX-HSZRJFAPSA-N |
| XLogP | 3.27 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |