C25H25N3O4 — CID 40986658
(13R)-13-(3-hydroxyphenyl)-3,5,10,10-tetramethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 40986658) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (13R)-13-(3-hydroxyphenyl)-3,5,10,10-tetramethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13R)-13-(3-hydroxyphenyl)-3,5,10,10-tetramethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 40986658 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (13R)-13-(3-hydroxyphenyl)-3,5,10,10-tetramethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)n3c(c2n(C)c1=O)[C@@H](c1cccc(O)c1)OCC3(C)C |
| InChI | InChI=1S/C25H25N3O4/c1-25(2)14-32-22(16-11-8-12-17(29)13-16)21-20-18(23(30)27(4)24(31)26(20)3)19(28(21)25)15-9-6-5-7-10-15/h5-13,22,29H,14H2,1-4H3/t22-/m1/s1 |
| InChIKey | SRIYXDHLYPAHGX-JOCHJYFZSA-N |
| XLogP | 3.27 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |