C28H25N3O5 — CID 41029355
(13S)-3,5,10,10-tetramethyl-13-(4-oxochromen-3-yl)-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 41029355) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is (13S)-3,5,10,10-tetramethyl-13-(4-oxochromen-3-yl)-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13S)-3,5,10,10-tetramethyl-13-(4-oxochromen-3-yl)-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 41029355 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (13S)-3,5,10,10-tetramethyl-13-(4-oxochromen-3-yl)-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)n3c(c2n(C)c1=O)[C@H](c1coc2ccccc2c1=O)OCC3(C)C |
| InChI | InChI=1S/C28H25N3O5/c1-28(2)15-36-25(18-14-35-19-13-9-8-12-17(19)24(18)32)23-22-20(26(33)30(4)27(34)29(22)3)21(31(23)28)16-10-6-5-7-11-16/h5-14,25H,15H2,1-4H3/t25-/m0/s1 |
| InChIKey | UWIIAVQPQGWRNW-VWLOTQADSA-N |
| XLogP | 3.67 |
| TPSA | 88.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |