C24H25N3O3S — CID 53044190
3,5,10,10-tetramethyl-8-(4-methylphenyl)-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 53044190) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is 3,5,10,10-tetramethyl-8-(4-methylphenyl)-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | 3,5,10,10-tetramethyl-8-(4-methylphenyl)-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 53044190 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3,5,10,10-tetramethyl-8-(4-methylphenyl)-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3n2C(C)(C)COC3c2cccs2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-14-8-10-15(11-9-14)18-17-19(25(4)23(29)26(5)22(17)28)20-21(16-7-6-12-31-16)30-13-24(2,3)27(18)20/h6-12,21H,13H2,1-5H3 |
| InChIKey | YLPMLCLPMNPTDR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |