C23H22ClN3O3S — CID 92717494
(13R)-8-(4-chlorophenyl)-3,5,10,10-tetramethyl-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 92717494) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is (13R)-8-(4-chlorophenyl)-3,5,10,10-tetramethyl-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13R)-8-(4-chlorophenyl)-3,5,10,10-tetramethyl-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 92717494 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (13R)-8-(4-chlorophenyl)-3,5,10,10-tetramethyl-13-thiophen-2-yl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cn1c(=O)c2c(-c3ccc(Cl)cc3)n3c(c2n(C)c1=O)[C@H](c1cccs1)OCC3(C)C |
| InChI | InChI=1S/C23H22ClN3O3S/c1-23(2)12-30-20(15-6-5-11-31-15)19-18-16(21(28)26(4)22(29)25(18)3)17(27(19)23)13-7-9-14(24)10-8-13/h5-11,20H,12H2,1-4H3/t20-/m0/s1 |
| InChIKey | SDAAGSAMFMRKBF-FQEVSTJZSA-N |
| XLogP | 4.28 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |