C26H24N4O4 — CID 41067394
(13S)-13-(1H-indol-3-yl)-8-(4-methoxyphenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 41067394) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is (13S)-13-(1H-indol-3-yl)-8-(4-methoxyphenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13S)-13-(1H-indol-3-yl)-8-(4-methoxyphenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 41067394 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (13S)-13-(1H-indol-3-yl)-8-(4-methoxyphenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | COc1ccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3n2CCO[C@H]3c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N4O4/c1-28-22-20(25(31)29(2)26(28)32)21(15-8-10-16(33-3)11-9-15)30-12-13-34-24(23(22)30)18-14-27-19-7-5-4-6-17(18)19/h4-11,14,24,27H,12-13H2,1-3H3/t24-/m0/s1 |
| InChIKey | OQUJNPPDFFCRIR-DEOSSOPVSA-N |
| XLogP | 3.32 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |