C23H20ClN3O3 — CID 41067326
(13S)-13-(2-chlorophenyl)-3,5-dimethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 41067326) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is (13S)-13-(2-chlorophenyl)-3,5-dimethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13S)-13-(2-chlorophenyl)-3,5-dimethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 41067326 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (13S)-13-(2-chlorophenyl)-3,5-dimethyl-8-phenyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cn1c(=O)c2c(-c3ccccc3)n3c(c2n(C)c1=O)[C@H](c1ccccc1Cl)OCC3 |
| InChI | InChI=1S/C23H20ClN3O3/c1-25-19-17(22(28)26(2)23(25)29)18(14-8-4-3-5-9-14)27-12-13-30-21(20(19)27)15-10-6-7-11-16(15)24/h3-11,21H,12-13H2,1-2H3/t21-/m0/s1 |
| InChIKey | GGSPGCOGOIZUDZ-NRFANRHFSA-N |
| XLogP | 3.48 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |