C26H27N3O4 — CID 53044414
3,5-dimethyl-8-phenyl-13-(2-propan-2-yloxyphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 53044414) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 3,5-dimethyl-8-phenyl-13-(2-propan-2-yloxyphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | 3,5-dimethyl-8-phenyl-13-(2-propan-2-yloxyphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 53044414 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 3,5-dimethyl-8-phenyl-13-(2-propan-2-yloxyphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | CC(C)Oc1ccccc1C1OCCn2c(-c3ccccc3)c3c(=O)n(C)c(=O)n(C)c3c21 |
| InChI | InChI=1S/C26H27N3O4/c1-16(2)33-19-13-9-8-12-18(19)24-23-22-20(25(30)28(4)26(31)27(22)3)21(29(23)14-15-32-24)17-10-6-5-7-11-17/h5-13,16,24H,14-15H2,1-4H3 |
| InChIKey | QEXWVNOLTRSCMF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |