C23H19Cl2N3O3 — CID 41067676
(13R)-8,13-bis(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 41067676) has the molecular formula C23H19Cl2N3O3 and a molecular weight of 456.33 g/mol. Its IUPAC name is (13R)-8,13-bis(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13R)-8,13-bis(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 41067676 |
| Molecular Formula | C23H19Cl2N3O3 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | (13R)-8,13-bis(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cn1c(=O)c2c(-c3ccc(Cl)cc3)n3c(c2n(C)c1=O)[C@@H](c1ccc(Cl)cc1)OCC3 |
| InChI | InChI=1S/C23H19Cl2N3O3/c1-26-19-17(22(29)27(2)23(26)30)18(13-3-7-15(24)8-4-13)28-11-12-31-21(20(19)28)14-5-9-16(25)10-6-14/h3-10,21H,11-12H2,1-2H3/t21-/m1/s1 |
| InChIKey | IJBTYQNEQDKBAH-OAQYLSRUSA-N |
| XLogP | 4.13 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |