C24H20ClN3O5 — CID 95059658
(13S)-13-(1,3-benzodioxol-5-yl)-8-(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 95059658) has the molecular formula C24H20ClN3O5 and a molecular weight of 465.89 g/mol. Its IUPAC name is (13S)-13-(1,3-benzodioxol-5-yl)-8-(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | (13S)-13-(1,3-benzodioxol-5-yl)-8-(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 95059658 |
| Molecular Formula | C24H20ClN3O5 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | (13S)-13-(1,3-benzodioxol-5-yl)-8-(4-chlorophenyl)-3,5-dimethyl-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cn1c(=O)c2c(-c3ccc(Cl)cc3)n3c(c2n(C)c1=O)[C@H](c1ccc2c(c1)OCO2)OCC3 |
| InChI | InChI=1S/C24H20ClN3O5/c1-26-20-18(23(29)27(2)24(26)30)19(13-3-6-15(25)7-4-13)28-9-10-31-22(21(20)28)14-5-8-16-17(11-14)33-12-32-16/h3-8,11,22H,9-10,12H2,1-2H3/t22-/m0/s1 |
| InChIKey | KTXRVTDPRKQTBW-QFIPXVFZSA-N |
| XLogP | 3.21 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |