C25H25N3O3 — CID 53044443
3,5-dimethyl-8-(3-methylphenyl)-13-(4-methylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione (PubChem CID 53044443) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3,5-dimethyl-8-(3-methylphenyl)-13-(4-methylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione.
| Compound Name | 3,5-dimethyl-8-(3-methylphenyl)-13-(4-methylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
|---|---|
| PubChem CID | 53044443 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 3,5-dimethyl-8-(3-methylphenyl)-13-(4-methylphenyl)-12-oxa-3,5,9-triazatricyclo[7.4.0.02,7]trideca-1,7-diene-4,6-dione |
| SMILES | Cc1ccc(C2OCCn3c(-c4cccc(C)c4)c4c(=O)n(C)c(=O)n(C)c4c32)cc1 |
| InChI | InChI=1S/C25H25N3O3/c1-15-8-10-17(11-9-15)23-22-21-19(24(29)27(4)25(30)26(21)3)20(28(22)12-13-31-23)18-7-5-6-16(2)14-18/h5-11,14,23H,12-13H2,1-4H3 |
| InChIKey | HSARJSZPWYCSIF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |