C12H14N2O3S — CID 4107402
methyl 2-[(2-cyanoacetyl)amino]-5-propylthiophene-3-carboxylate (PubChem CID 4107402) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl 2-[(2-cyanoacetyl)amino]-5-propylthiophene-3-carboxylate.
| Compound Name | methyl 2-[(2-cyanoacetyl)amino]-5-propylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4107402 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | methyl 2-[(2-cyanoacetyl)amino]-5-propylthiophene-3-carboxylate |
| SMILES | CCCc1cc(C(=O)OC)c(NC(=O)CC#N)s1 |
| InChI | InChI=1S/C12H14N2O3S/c1-3-4-8-7-9(12(16)17-2)11(18-8)14-10(15)5-6-13/h7H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | IBYVSQHFHWKMHP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |