C25H27NO8 — CID 41078147
methyl 4-[(2S)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 41078147) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is methyl 4-[(2S)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(2S)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 41078147 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl 4-[(2S)-3-[(4-ethoxyphenyl)-hydroxymethylidene]-1-[2-(2-hydroxyethoxy)ethyl]-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | CCOc1ccc(C(O)=C2C(=O)C(=O)N(CCOCCO)[C@H]2c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C25H27NO8/c1-3-34-19-10-8-17(9-11-19)22(28)20-21(16-4-6-18(7-5-16)25(31)32-2)26(24(30)23(20)29)12-14-33-15-13-27/h4-11,21,27-28H,3,12-15H2,1-2H3/t21-/m0/s1 |
| InChIKey | LSCPMHWBSIKVMS-NRFANRHFSA-N |
| XLogP | 2.30 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|