C25H23N3O3S — CID 41079124
N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 41079124) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 41079124 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-2-[(4S)-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)N[C@H]2CCSc3ccccc32)C1=O |
| InChI | InChI=1S/C25H23N3O3S/c1-25(18-11-10-16-6-2-3-7-17(16)14-18)23(30)28(24(31)27-25)15-22(29)26-20-12-13-32-21-9-5-4-8-19(20)21/h2-11,14,20H,12-13,15H2,1H3,(H,26,29)(H,27,31)/t20-,25-/m0/s1 |
| InChIKey | YEOCKYFVDYLCAW-CPJSRVTESA-N |
| XLogP | 3.96 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|