C33H31NO5 — CID 41079596
(5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione (PubChem CID 41079596) has the molecular formula C33H31NO5 and a molecular weight of 521.61 g/mol. Its IUPAC name is (5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41079596 |
| Molecular Formula | C33H31NO5 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propan-2-ylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(COc2ccc(C(O)=C3C(=O)C(=O)N(Cc4ccco4)[C@@H]3c3ccc(C(C)C)cc3)cc2)c1 |
| InChI | InChI=1S/C33H31NO5/c1-21(2)24-9-11-25(12-10-24)30-29(32(36)33(37)34(30)19-28-8-5-17-38-28)31(35)26-13-15-27(16-14-26)39-20-23-7-4-6-22(3)18-23/h4-18,21,30,35H,19-20H2,1-3H3/t30-/m1/s1 |
| InChIKey | IHGSLGPZHWPBTC-SSEXGKCCSA-N |
| XLogP | 6.91 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|