C33H31NO6 — CID 98345765
(4E,5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98345765) has the molecular formula C33H31NO6 and a molecular weight of 537.61 g/mol. Its IUPAC name is (4E,5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98345765 |
| Molecular Formula | C33H31NO6 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.22 |
| IUPAC Name | (4E,5R)-1-(furan-2-ylmethyl)-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-(4-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc([C@@H]2/C(=C(\O)c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2Cc2ccco2)cc1 |
| InChI | InChI=1S/C33H31NO6/c1-3-17-38-26-13-9-24(10-14-26)30-29(32(36)33(37)34(30)20-28-8-5-18-39-28)31(35)25-11-15-27(16-12-25)40-21-23-7-4-6-22(2)19-23/h4-16,18-19,30,35H,3,17,20-21H2,1-2H3/b31-29+/t30-/m1/s1 |
| InChIKey | XRGCSSNRFIZKFV-VEZPTTSMSA-N |
| XLogP | 6.58 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|