C29H24N2O5S — CID 41080722
(5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 41080722) has the molecular formula C29H24N2O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is (5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 41080722 |
| Molecular Formula | C29H24N2O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | (5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc([C@@H]2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2c2nc3c(C)cc(C)cc3s2)cc1 |
| InChI | InChI=1S/C29H24N2O5S/c1-15-4-6-18(7-5-15)25-23(26(32)19-8-9-20-21(14-19)36-11-10-35-20)27(33)28(34)31(25)29-30-24-17(3)12-16(2)13-22(24)37-29/h4-9,12-14,25,32H,10-11H2,1-3H3/t25-/m1/s1 |
| InChIKey | SHBFOLFOIWCVRK-RUZDIDTESA-N |
| XLogP | 5.62 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|