C25H30N4O2S2 — CID 41082508
(2R)-4-[3-(7-methyloctyl)-4-oxoquinazolin-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile (PubChem CID 41082508) has the molecular formula C25H30N4O2S2 and a molecular weight of 482.68 g/mol. Its IUPAC name is (2R)-4-[3-(7-methyloctyl)-4-oxoquinazolin-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile.
| Compound Name | (2R)-4-[3-(7-methyloctyl)-4-oxoquinazolin-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile |
|---|---|
| PubChem CID | 41082508 |
| Molecular Formula | C25H30N4O2S2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (2R)-4-[3-(7-methyloctyl)-4-oxoquinazolin-2-yl]sulfanyl-2-(4-methyl-1,3-thiazol-2-yl)-3-oxobutanenitrile |
| SMILES | Cc1csc([C@H](C#N)C(=O)CSc2nc3ccccc3c(=O)n2CCCCCCC(C)C)n1 |
| InChI | InChI=1S/C25H30N4O2S2/c1-17(2)10-6-4-5-9-13-29-24(31)19-11-7-8-12-21(19)28-25(29)33-16-22(30)20(14-26)23-27-18(3)15-32-23/h7-8,11-12,15,17,20H,4-6,9-10,13,16H2,1-3H3/t20-/m1/s1 |
| InChIKey | RKHFEVUWILTTTB-HXUWFJFHSA-N |
| XLogP | 5.74 |
| TPSA | 88.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|