C19H17F3N4O3S — CID 41082763
(2S)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide (PubChem CID 41082763) has the molecular formula C19H17F3N4O3S and a molecular weight of 438.43 g/mol. Its IUPAC name is (2S)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide.
| Compound Name | (2S)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
|---|---|
| PubChem CID | 41082763 |
| Molecular Formula | C19H17F3N4O3S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (2S)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]propanamide |
| SMILES | COc1ccc2nc(S[C@@H](C)C(=O)NCC(=O)Nc3ccc(F)c(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C19H17F3N4O3S/c1-9(30-19-25-12-5-3-10(29-2)7-14(12)26-19)18(28)23-8-15(27)24-13-6-4-11(20)16(21)17(13)22/h3-7,9H,8H2,1-2H3,(H,23,28)(H,24,27)(H,25,26)/t9-/m0/s1 |
| InChIKey | KTRFTOXUXCDCNC-VIFPVBQESA-N |
| XLogP | 3.22 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|