C24H20N4O4 — CID 41084628
3-[3-[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]indol-1-yl]propanenitrile (PubChem CID 41084628) has the molecular formula C24H20N4O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is 3-[3-[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 41084628 |
| Molecular Formula | C24H20N4O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-[3-[2-[(4R)-2',5'-dioxospiro[2,3-dihydrochromene-4,4'-imidazolidine]-1'-yl]acetyl]indol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(C(=O)CN2C(=O)N[C@@]3(CCOc4ccccc43)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H20N4O4/c25-11-5-12-27-14-17(16-6-1-3-8-19(16)27)20(29)15-28-22(30)24(26-23(28)31)10-13-32-21-9-4-2-7-18(21)24/h1-4,6-9,14H,5,10,12-13,15H2,(H,26,31)/t24-/m1/s1 |
| InChIKey | QKKCIBHLSGGGCV-XMMPIXPASA-N |
| XLogP | 2.97 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|