C24H22N4O3 — CID 7175021
3-[3-[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]indol-1-yl]propanenitrile (PubChem CID 7175021) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-[3-[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]indol-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]indol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 7175021 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-[3-[2-[(4R)-4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl]acetyl]indol-1-yl]propanenitrile |
| SMILES | CC[C@]1(c2ccccc2)NC(=O)N(CC(=O)c2cn(CCC#N)c3ccccc23)C1=O |
| InChI | InChI=1S/C24H22N4O3/c1-2-24(17-9-4-3-5-10-17)22(30)28(23(31)26-24)16-21(29)19-15-27(14-8-13-25)20-12-7-6-11-18(19)20/h3-7,9-12,15H,2,8,14,16H2,1H3,(H,26,31)/t24-/m1/s1 |
| InChIKey | NKNZSMDLWWSXFA-XMMPIXPASA-N |
| XLogP | 3.59 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|