C14H16N3O4S- — CID 4108465
[4-(butanoylamino)phenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide (PubChem CID 4108465) has the molecular formula C14H16N3O4S- and a molecular weight of 322.37 g/mol. Its IUPAC name is [4-(butanoylamino)phenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide.
| Compound Name | [4-(butanoylamino)phenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide |
|---|---|
| PubChem CID | 4108465 |
| Molecular Formula | C14H16N3O4S- |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | [4-(butanoylamino)phenyl]sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide |
| SMILES | CCCC(=O)Nc1ccc(S(=O)(=O)[N-]c2cc(C)on2)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c1-3-4-14(18)15-11-5-7-12(8-6-11)22(19,20)17-13-9-10(2)21-16-13/h5-9H,3-4H2,1-2H3,(H2,15,16,17,18)/p-1 |
| InChIKey | NSSZHSOZCMVLGS-UHFFFAOYSA-M |
| XLogP | 3.12 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |