C10H10AgN3O3S — CID 4164477
silver (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide (PubChem CID 4164477) has the molecular formula C10H10AgN3O3S and a molecular weight of 360.14 g/mol. Its IUPAC name is silver (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide.
| Compound Name | silver (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide |
|---|---|
| PubChem CID | 4164477 |
| Molecular Formula | C10H10AgN3O3S |
| Molecular Weight | 360.14 g/mol |
| Exact Mass | 358.95 |
| IUPAC Name | silver (4-aminophenyl)sulfonyl-(5-methyl-1,2-oxazol-3-yl)azanide |
| SMILES | Cc1cc([N-]S(=O)(=O)c2ccc(N)cc2)no1.[Ag+] |
| InChI | InChI=1S/C10H10N3O3S.Ag/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9;/h2-6H,11H2,1H3;/q-1;+1 |
| InChIKey | UZFHYVJIBTWFSF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|