C11H12KN3O3S — CID 177463125
potassium (4-aminophenyl)sulfonyl-(3,4-dimethyl-1,2-oxazol-5-yl)azanide (PubChem CID 177463125) has the molecular formula C11H12KN3O3S and a molecular weight of 305.40 g/mol. Its IUPAC name is potassium (4-aminophenyl)sulfonyl-(3,4-dimethyl-1,2-oxazol-5-yl)azanide.
| Compound Name | potassium (4-aminophenyl)sulfonyl-(3,4-dimethyl-1,2-oxazol-5-yl)azanide |
|---|---|
| PubChem CID | 177463125 |
| Molecular Formula | C11H12KN3O3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | potassium (4-aminophenyl)sulfonyl-(3,4-dimethyl-1,2-oxazol-5-yl)azanide |
| SMILES | Cc1noc([N-]S(=O)(=O)c2ccc(N)cc2)c1C.[K+] |
| InChI | InChI=1S/C11H12N3O3S.K/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10;/h3-6H,12H2,1-2H3;/q-1;+1 |
| InChIKey | HBPLLQLTYIKGBE-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|