About (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium
(4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium (PubChem CID 139061231) has the molecular formula C16H22N4O2S
and a molecular weight of 334.44 g/mol. Its IUPAC name is (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium.
Molecular Properties
| Compound Name | (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium |
| PubChem CID | 139061231 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.Nc1ccc(S(=O)(=O)[N-]c2ccccn2)cc1 |
| InChI | InChI=1S/C11H10N3O2S.C5H11N/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2-4-6-5-3-1/h1-8H,12H2;6H,1-5H2/q-1;/p+1 |
| InChIKey | OIVZPZOLDWGOHB-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium?
The IUPAC name of (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium (CID 139061231) is (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium.
What is the SMILES notation for (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium?
The canonical SMILES for (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium is C1CC[NH2+]CC1.Nc1ccc(S(=O)(=O)[N-]c2ccccn2)cc1.
What is the InChIKey of (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium?
The InChIKey is OIVZPZOLDWGOHB-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H10N3O2S.C5H11N/c12-9-4-6-10(7-5-9)17(15,16)14-11-3-1-2-8-13-11;1-2-4-6-5-3-1/h1-8H,12H2;6H,1-5H2/q-1;/p+1.
What are the key properties of (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium?
(4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium has a molecular weight of 334.44 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)sulfonyl-pyridin-2-ylazanide;piperidin-1-ium is sourced from PubChem (CID 139061231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).