C23H20ClN3OS2 — CID 41086010
N-(4-chloro-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 41086010) has the molecular formula C23H20ClN3OS2 and a molecular weight of 454.02 g/mol. Its IUPAC name is N-(4-chloro-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 41086010 |
| Molecular Formula | C23H20ClN3OS2 |
| Molecular Weight | 454.02 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | N-(4-chloro-1,3-benzothiazol-2-yl)-4-phenylsulfanyl-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | O=C(CCCSc1ccccc1)N(Cc1ccccn1)c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C23H20ClN3OS2/c24-19-11-6-12-20-22(19)26-23(30-20)27(16-17-8-4-5-14-25-17)21(28)13-7-15-29-18-9-2-1-3-10-18/h1-6,8-12,14H,7,13,15-16H2 |
| InChIKey | XQAVIJFVPVBMAP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.02 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|