C26H26FN3OS2 — CID 16841758
4-(4-fluorophenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)butanamide (PubChem CID 16841758) has the molecular formula C26H26FN3OS2 and a molecular weight of 479.65 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)butanamide.
| Compound Name | 4-(4-fluorophenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 16841758 |
| Molecular Formula | C26H26FN3OS2 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 4-(4-fluorophenyl)sulfanyl-N-(4-propan-2-yl-1,3-benzothiazol-2-yl)-N-(pyridin-2-ylmethyl)butanamide |
| SMILES | CC(C)c1cccc2sc(N(Cc3ccccn3)C(=O)CCCSc3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C26H26FN3OS2/c1-18(2)22-8-5-9-23-25(22)29-26(33-23)30(17-20-7-3-4-15-28-20)24(31)10-6-16-32-21-13-11-19(27)12-14-21/h3-5,7-9,11-15,18H,6,10,16-17H2,1-2H3 |
| InChIKey | NGLUDLDVLLLDSZ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|