C24H25Cl2N3O3 — CID 41088760
2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide (PubChem CID 41088760) has the molecular formula C24H25Cl2N3O3 and a molecular weight of 474.39 g/mol. Its IUPAC name is 2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide.
| Compound Name | 2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 41088760 |
| Molecular Formula | C24H25Cl2N3O3 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 2-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1R)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]acetamide |
| SMILES | C[C@@H](NC(=O)CN1C(=O)N[C@](C)(c2ccc(Cl)cc2Cl)C1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C24H25Cl2N3O3/c1-14(16-8-7-15-5-3-4-6-17(15)11-16)27-21(30)13-29-22(31)24(2,28-23(29)32)19-10-9-18(25)12-20(19)26/h7-12,14H,3-6,13H2,1-2H3,(H,27,30)(H,28,32)/t14-,24-/m1/s1 |
| InChIKey | LZXQYORDGZCJLW-JBEBIEQOSA-N |
| XLogP | 4.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|