C18H17Cl2N3O4 — CID 8570970
2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 8570970) has the molecular formula C18H17Cl2N3O4 and a molecular weight of 410.26 g/mol. Its IUPAC name is 2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8570970 |
| Molecular Formula | C18H17Cl2N3O4 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 2-[(4S)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1C(=O)N[C@@](C)(c2ccc(Cl)cc2Cl)C1=O)c1ccco1 |
| InChI | InChI=1S/C18H17Cl2N3O4/c1-10(14-4-3-7-27-14)21-15(24)9-23-16(25)18(2,22-17(23)26)12-6-5-11(19)8-13(12)20/h3-8,10H,9H2,1-2H3,(H,21,24)(H,22,26)/t10-,18-/m0/s1 |
| InChIKey | APFMMGSPPWMUCN-YPMLDQLKSA-N |
| XLogP | 3.23 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|