C17H17Cl3N2O — CID 4109111
2-phenyl-N-[2,2,2-trichloro-1-(4-methylanilino)ethyl]acetamide (PubChem CID 4109111) has the molecular formula C17H17Cl3N2O and a molecular weight of 371.70 g/mol. Its IUPAC name is 2-phenyl-N-[2,2,2-trichloro-1-(4-methylanilino)ethyl]acetamide.
| Compound Name | 2-phenyl-N-[2,2,2-trichloro-1-(4-methylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 4109111 |
| Molecular Formula | C17H17Cl3N2O |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-phenyl-N-[2,2,2-trichloro-1-(4-methylanilino)ethyl]acetamide |
| SMILES | Cc1ccc(NC(NC(=O)Cc2ccccc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H17Cl3N2O/c1-12-7-9-14(10-8-12)21-16(17(18,19)20)22-15(23)11-13-5-3-2-4-6-13/h2-10,16,21H,11H2,1H3,(H,22,23) |
| InChIKey | QQQDGXMTSKIYGN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|