C23H23NO5 — CID 41091483
7-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]-3-phenylchromen-4-one (PubChem CID 41091483) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 7-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]-3-phenylchromen-4-one.
| Compound Name | 7-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]-3-phenylchromen-4-one |
|---|---|
| PubChem CID | 41091483 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 7-[2-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethoxy]-3-phenylchromen-4-one |
| SMILES | C[C@@H]1CN(C(=O)COc2ccc3c(=O)c(-c4ccccc4)coc3c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C23H23NO5/c1-15-11-24(12-16(2)29-15)22(25)14-27-18-8-9-19-21(10-18)28-13-20(23(19)26)17-6-4-3-5-7-17/h3-10,13,15-16H,11-12,14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | HYPYXCDOMVKBMZ-HZPDHXFCSA-N |
| XLogP | 3.47 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |