C27H30N2O5 — CID 121309110
7-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-3-(4-tert-butylphenyl)chromen-4-one (PubChem CID 121309110) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 7-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-3-(4-tert-butylphenyl)chromen-4-one.
| Compound Name | 7-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-3-(4-tert-butylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 121309110 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 7-[2-(4-acetylpiperazin-1-yl)-2-oxoethoxy]-3-(4-tert-butylphenyl)chromen-4-one |
| SMILES | CC(=O)N1CCN(C(=O)COc2ccc3c(=O)c(-c4ccc(C(C)(C)C)cc4)coc3c2)CC1 |
| InChI | InChI=1S/C27H30N2O5/c1-18(30)28-11-13-29(14-12-28)25(31)17-33-21-9-10-22-24(15-21)34-16-23(26(22)32)19-5-7-20(8-6-19)27(2,3)4/h5-10,15-16H,11-14,17H2,1-4H3 |
| InChIKey | NTVULYBQTQTQCT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |