C25H25NO6 — CID 166201379
7-[2-(3-cyclopropylmorpholin-4-yl)-2-oxoethoxy]-3-(4-methoxyphenyl)chromen-4-one (PubChem CID 166201379) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 7-[2-(3-cyclopropylmorpholin-4-yl)-2-oxoethoxy]-3-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 7-[2-(3-cyclopropylmorpholin-4-yl)-2-oxoethoxy]-3-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 166201379 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 7-[2-(3-cyclopropylmorpholin-4-yl)-2-oxoethoxy]-3-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2coc3cc(OCC(=O)N4CCOCC4C4CC4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C25H25NO6/c1-29-18-6-4-16(5-7-18)21-13-32-23-12-19(8-9-20(23)25(21)28)31-15-24(27)26-10-11-30-14-22(26)17-2-3-17/h4-9,12-13,17,22H,2-3,10-11,14-15H2,1H3 |
| InChIKey | GNDMKZHKCUVZOD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |