C22H18F3NO6 — CID 121309102
7-(2-morpholin-4-yl-2-oxoethoxy)-3-[4-(trifluoromethoxy)phenyl]chromen-4-one (PubChem CID 121309102) has the molecular formula C22H18F3NO6 and a molecular weight of 449.38 g/mol. Its IUPAC name is 7-(2-morpholin-4-yl-2-oxoethoxy)-3-[4-(trifluoromethoxy)phenyl]chromen-4-one.
| Compound Name | 7-(2-morpholin-4-yl-2-oxoethoxy)-3-[4-(trifluoromethoxy)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 121309102 |
| Molecular Formula | C22H18F3NO6 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 7-(2-morpholin-4-yl-2-oxoethoxy)-3-[4-(trifluoromethoxy)phenyl]chromen-4-one |
| SMILES | O=C(COc1ccc2c(=O)c(-c3ccc(OC(F)(F)F)cc3)coc2c1)N1CCOCC1 |
| InChI | InChI=1S/C22H18F3NO6/c23-22(24,25)32-15-3-1-14(2-4-15)18-12-31-19-11-16(5-6-17(19)21(18)28)30-13-20(27)26-7-9-29-10-8-26/h1-6,11-12H,7-10,13H2 |
| InChIKey | FHMIXAAEZMBSMN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |