C23H19ClN4O — CID 4109180
6-[1-(4-chlorophenyl)pyrazol-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide (PubChem CID 4109180) has the molecular formula C23H19ClN4O and a molecular weight of 402.89 g/mol. Its IUPAC name is 6-[1-(4-chlorophenyl)pyrazol-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide.
| Compound Name | 6-[1-(4-chlorophenyl)pyrazol-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4109180 |
| Molecular Formula | C23H19ClN4O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 6-[1-(4-chlorophenyl)pyrazol-4-yl]-N-(2-phenylethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccc(-c2cnn(-c3ccc(Cl)cc3)c2)nc1 |
| InChI | InChI=1S/C23H19ClN4O/c24-20-7-9-21(10-8-20)28-16-19(15-27-28)22-11-6-18(14-26-22)23(29)25-13-12-17-4-2-1-3-5-17/h1-11,14-16H,12-13H2,(H,25,29) |
| InChIKey | YBEKOQMBLMYEGE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |