C22H18ClN3O4 — CID 41093768
(4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-ethyl-2,3-dihydro-1H-benzo[b][1,6]naphthyridin-2-ium-10-carboxylate (PubChem CID 41093768) has the molecular formula C22H18ClN3O4 and a molecular weight of 423.86 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-ethyl-2,3-dihydro-1H-benzo[b][1,6]naphthyridin-2-ium-10-carboxylate.
| Compound Name | (4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-ethyl-2,3-dihydro-1H-benzo[b][1,6]naphthyridin-2-ium-10-carboxylate |
|---|---|
| PubChem CID | 41093768 |
| Molecular Formula | C22H18ClN3O4 |
| Molecular Weight | 423.86 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (4E)-4-[(4-chloro-3-nitrophenyl)methylidene]-2-ethyl-2,3-dihydro-1H-benzo[b][1,6]naphthyridin-2-ium-10-carboxylate |
| SMILES | CC[NH+]1C/C(=C\c2ccc(Cl)c([N+](=O)[O-])c2)c2nc3ccccc3c(C(=O)[O-])c2C1 |
| InChI | InChI=1S/C22H18ClN3O4/c1-2-25-11-14(9-13-7-8-17(23)19(10-13)26(29)30)21-16(12-25)20(22(27)28)15-5-3-4-6-18(15)24-21/h3-10H,2,11-12H2,1H3,(H,27,28)/b14-9+ |
| InChIKey | ZXWRKVMZXZBTKJ-NTEUORMPSA-N |
| XLogP | 2.12 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|