C22H18N2O4 — CID 45463969
(4E)-2-methyl-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid (PubChem CID 45463969) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is (4E)-2-methyl-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid.
| Compound Name | (4E)-2-methyl-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid |
|---|---|
| PubChem CID | 45463969 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | (4E)-2-methyl-4-[(3-nitrophenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxylic acid |
| SMILES | CC1C/C(=C\c2cccc([N+](=O)[O-])c2)c2nc3ccccc3c(C(=O)O)c2C1 |
| InChI | InChI=1S/C22H18N2O4/c1-13-9-15(11-14-5-4-6-16(12-14)24(27)28)21-18(10-13)20(22(25)26)17-7-2-3-8-19(17)23-21/h2-8,11-13H,9-10H2,1H3,(H,25,26)/b15-11+ |
| InChIKey | YZSLBWIMXHUYEX-RVDMUPIBSA-N |
| XLogP | 4.96 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|