C21H28N2O4 — CID 41095730
N-[2-[[(1S)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 41095730) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-[[(1S)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[(1S)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 41095730 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[2-[[(1S)-1-(7-ethoxy-1-benzofuran-2-yl)ethyl]amino]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | CCOc1cccc2cc([C@H](C)NC(=O)CNC(=O)C3CCCCC3)oc12 |
| InChI | InChI=1S/C21H28N2O4/c1-3-26-17-11-7-10-16-12-18(27-20(16)17)14(2)23-19(24)13-22-21(25)15-8-5-4-6-9-15/h7,10-12,14-15H,3-6,8-9,13H2,1-2H3,(H,22,25)(H,23,24)/t14-/m0/s1 |
| InChIKey | HDMVVYIMQGEZSU-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |