C21H29N3O4 — CID 86831296
N-cyclopentyl-3-[1-(7-ethoxy-1-benzofuran-2-yl)ethylcarbamoylamino]propanamide (PubChem CID 86831296) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-cyclopentyl-3-[1-(7-ethoxy-1-benzofuran-2-yl)ethylcarbamoylamino]propanamide.
| Compound Name | N-cyclopentyl-3-[1-(7-ethoxy-1-benzofuran-2-yl)ethylcarbamoylamino]propanamide |
|---|---|
| PubChem CID | 86831296 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | N-cyclopentyl-3-[1-(7-ethoxy-1-benzofuran-2-yl)ethylcarbamoylamino]propanamide |
| SMILES | CCOc1cccc2cc(C(C)NC(=O)NCCC(=O)NC3CCCC3)oc12 |
| InChI | InChI=1S/C21H29N3O4/c1-3-27-17-10-6-7-15-13-18(28-20(15)17)14(2)23-21(26)22-12-11-19(25)24-16-8-4-5-9-16/h6-7,10,13-14,16H,3-5,8-9,11-12H2,1-2H3,(H,24,25)(H2,22,23,26) |
| InChIKey | OVXBMIKRKFBLOK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |