C18H15NO — CID 4109851
2-phenyl-1,3-dihydrobenzo[f][1,3]benzoxazine (PubChem CID 4109851) has the molecular formula C18H15NO and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-phenyl-1,3-dihydrobenzo[f][1,3]benzoxazine.
| Compound Name | 2-phenyl-1,3-dihydrobenzo[f][1,3]benzoxazine |
|---|---|
| PubChem CID | 4109851 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-phenyl-1,3-dihydrobenzo[f][1,3]benzoxazine |
| SMILES | c1ccc(N2COc3ccc4ccccc4c3C2)cc1 |
| InChI | InChI=1S/C18H15NO/c1-2-7-15(8-3-1)19-12-17-16-9-5-4-6-14(16)10-11-18(17)20-13-19/h1-11H,12-13H2 |
| InChIKey | PDMUYWRZQIJPBH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |