C19H17NO — CID 4109852
2-(3-methylphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine (PubChem CID 4109852) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(3-methylphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine.
| Compound Name | 2-(3-methylphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine |
|---|---|
| PubChem CID | 4109852 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-(3-methylphenyl)-1,3-dihydrobenzo[f][1,3]benzoxazine |
| SMILES | Cc1cccc(N2COc3ccc4ccccc4c3C2)c1 |
| InChI | InChI=1S/C19H17NO/c1-14-5-4-7-16(11-14)20-12-18-17-8-3-2-6-15(17)9-10-19(18)21-13-20/h2-11H,12-13H2,1H3 |
| InChIKey | ZROYJIFSDLWVLQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |